| Identification |
| Name: | Boronic acid,B-[2-chloro-4-(1-methylethoxy)phenyl]- |
| Synonyms: | Boronicacid, [2-chloro-4-(1-methylethoxy)phenyl]- (9CI);2-Chloro-4-isopropoxybenzeneboronic acid |
| CAS: | 313545-47-0 |
| Molecular Formula: | C9H12 B Cl O3 |
| Molecular Weight: | 214.45 |
| InChI: | InChI=1/C9H12BClO3/c1-6(2)14-7-3-4-8(10(12)13)9(11)5-7/h3-6,12-13H,1-2H3 |
| Molecular Structure: |
![(C9H12BClO3) Boronicacid, [2-chloro-4-(1-methylethoxy)phenyl]- (9CI);2-Chloro-4-isopropoxybenzeneboronic acid](https://img1.guidechem.com/chem/e/dict/17/313545-47-0.jpg) |
| Properties |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.529 |
| Safety Data |
| |
 |