| Identification | |
| Name: | Acetamide,N-(3-isothiocyanatophenyl)- |
| Synonyms: | Isothiocyanicacid, m-acetamidophenyl ester (7CI,8CI); 3-Acetamidophenyl isothiocyanate |
| CAS: | 3137-83-5 |
| EINECS: | 221-536-3 |
| Molecular Formula: | C9H8 N2 O S |
| Molecular Weight: | 192.25 |
| InChI: | InChI=1/C9H8N2OS/c1-7(12)11-9-4-2-3-8(5-9)10-6-13/h2-5H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 206°C |
| Boiling Point: | 417°Cat760mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.595 |
| Specification: |
Isothiocyanic acid-m-acetamidophenyl ester ,its cas register number is 620-42-8. It also can be called 3-Acetamidophenyl isothiocyanate ; BRN 2643286 ; EINECS 221-536-3 and N-(3-Isothiocyanatophenyl)acetamide .When Isothiocyanic acid-m-acetamidophenyl ester (CAS NO.3137-83-5) is heated to decomposition, it emits toxic fumes of SOx. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 206°C |
| Safety Data | |
 |
|
