| Identification | |
| Name: | Piperidine,1-methyl-4-(9H-thioxanthen-9-ylidene)- |
| Synonyms: | Piperidine,1-methyl-4-thioxanthen-9-ylidene- (7CI,8CI);9-(1-Methyl-4-piperidinylidene)thioxanthene; 9-(N-Methyl-4'-piperidylene)thioxanthene;9-(N-Methyl-4'-piperidylidene)-thioxanthene; BP 400; BP 400S; CGA 123427;Calmixen; Mepithiathene; Pimethixene; Pimetixene |
| CAS: | 314-03-4 |
| EINECS: | 206-240-4 |
| Molecular Formula: | C19H19 N S |
| Molecular Weight: | 293.45 |
| InChI: | InChI=1/C19H19NS/c1-20-12-10-14(11-13-20)19-15-6-2-4-8-17(15)21-18-9-5-3-7-16(18)19/h2-9H,10-13H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219.7°C |
| Boiling Point: | 439.7°Cat760mmHg |
| Density: | 1.192g/cm3 |
| Refractive index: | 1.661 |
| Specification: |
Pimethixene, its cas register number is 314-03-4. It also can be called Pimethixenum ; Mepithiathene ; 1-Methyl-4-(thioxanthen-9-ylidene)piperidine ; and 9-(1-Methyl-4-piperidylidene)thioxanthene . It is an antihistamine and anticholinergic of the thioxanthene chemical class. |
| Flash Point: | 219.7°C |
| Safety Data | |
 |
|
