| Identification |
| Name: | tetrapropyl benzene-1,2,4,5-tetracarboxylate |
| Synonyms: | 1,2,4,5-benzenetetracarboxylic acid, tetrapropyl ester;Tetrapropyl benzene-1,2,4,5-tetracarboxylate |
| CAS: | 3143-08-6 |
| Molecular Formula: | C22H30O8 |
| Molecular Weight: | 422.4688 |
| InChI: | InChI=1/C22H30O8/c1-5-9-27-19(23)15-13-17(21(25)29-11-7-3)18(22(26)30-12-8-4)14-16(15)20(24)28-10-6-2/h13-14H,5-12H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 203.5°C |
| Boiling Point: | 478.4°C at 760 mmHg |
| Density: | 1.132g/cm3 |
| Refractive index: | 1.503 |
| Flash Point: | 203.5°C |
| Safety Data |
| |
 |