| Identification |
| Name: | 3,6,9,12,15,18,21,24,27-Nonaoxanonacosan-1-ol,29-(4-octylphenoxy)- |
| Synonyms: | 3,6,9,12,15,18,21,24,27-Nonaoxanonacosan-1-ol,29-(p-octylphenoxy)- (7CI,8CI); Decaethylene glycol mono(p-octylphenyl) ether |
| CAS: | 3151-30-2 |
| Molecular Formula: | C34H62 O11 |
| Molecular Weight: | 646.8495 |
| InChI: | InChI=1/C34H62O11/c1-2-3-4-5-6-7-8-33-9-11-34(12-10-33)45-32-31-44-30-29-43-28-27-42-26-25-41-24-23-40-22-21-39-20-19-38-18-17-37-16-15-36-14-13-35/h9-12,35H,2-8,13-32H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 365.2°C |
| Boiling Point: | 680.2°C at 760 mmHg |
| Density: | 1.054g/cm3 |
| Refractive index: | 1.483 |
| Flash Point: | 365.2°C |
| Safety Data |
| |
 |