| Identification |
| Name: | 2-Thiophenecarbonylchloride, 5-methyl- |
| Synonyms: | 5-Methyl-2-thenoylchloride;5-Methyl-2-thienoyl chloride;5-Methyl-2-thiophenecarbonyl chloride;2-Thiophenecarbonyl chloride, 5-methyl-; |
| CAS: | 31555-59-6 |
| Molecular Formula: | C6H5ClOS |
| Molecular Weight: | 160.62 |
| InChI: | InChI=1/C6H5ClOS/c1-4-2-3-5(9-4)6(7)8/h2-3H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 93.4°C |
| Boiling Point: | 230.8°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.566 |
| Flash Point: | 93.4°C |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |