| Identification | |
| Name: | 2-hydroxypropanoic acid |
| Synonyms: | Polactide;Propanoic acid, 2-hydroxy-, (+-)-, homopolymer;Propanoic acid, 2-hydroxy-, homopolymer |
| CAS: | 31587-11-8 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 16.8 deg C |
| Boiling Point: | 122 deg C at 15 mm Hg |
| Solubility: | Miscible with alcohol, glycerol, and furfural Soluble in alcohol and furfurol; slightly soluble in ether; insoluble in chloroform, petroleum ether, carbon disulfide. Miscible in alcohol-ether solution. In water, miscible |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Safety Data | |
 |
|
