| Identification | |
| Name: | L(+)-Ornithine hydrochloride |
| CAS: | 3184-13-2 |
| EINECS: | 221-678-6 |
| Molecular Formula: | C5H13ClN2O2 |
| Molecular Weight: | 168.62192 |
| InChI: | InChI=1S/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.5 oC |
| Boiling Point: | 308.7 oC at 760 mmHg |
| Density: | 1.57 |
| Stability: | Stable. |
| Alpha: | 24 o (C=4, 6N HCL) |
| Water Solubility: | H2O: 100 mg/mL |
| Solubility: | H2O: 100 mg/mL |
| Appearance: | white powder |
| HS Code: | 29224995 |
| Flash Point: | 140.5 oC |
| Storage Temperature: | Store at RT. |
| Usage: | One of the materials produced during the urea cycle. |
| Safety Data | |
 |
|
