| Identification | |
| Name: | Phenol,4-chloro-2-(phenylmethyl)-, sodium salt (1:1) |
| Synonyms: | Phenol,4-chloro-2-(phenylmethyl)-, sodium salt (9CI); o-Cresol, 4-chloro-a-phenyl-, sodium salt (8CI);Sodium 2-benzyl-4-chlorophenolate; Sodium o-benzyl-p-chlorophenate |
| CAS: | 3184-65-4 |
| EINECS: | 221-681-2 |
| Molecular Formula: | C13H11 Cl O . Na |
| Molecular Weight: | 241.68 |
| InChI: | InChI=1/C13H11ClO.Na/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10;/h1-7,9,15H,8H2;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 48.5 deg C |
| Flash Point: | 159.2°C |
| Boiling Point: | 339.6°Cat760mmHg |
| Density: | 1.22g/cm3 |
| Solubility: | Highly sol in alcohol and other org solvents In water, 149 mg/L at 25 deg C |
| Specification: |
The extinguishing agent of Sodium o-benzyl-p-chlorophenate (CAS No.3184-65-4) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 159.2°C |
| Color: | White to light tan or pink flakes |
| Safety Data | |
 |
|
