| Identification | |
| Name: | D-Isoleucine |
| Synonyms: | Isoleucine,D- (8CI);(R)-Isoleucine;(2R,3R)-2-Amino-3-methylpentanoic acid; |
| CAS: | 319-78-8 |
| EINECS: | 206-269-2 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.035g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -37 o (C=5, 1 N HCL 24 oC) |
| Solubility: | Very soluble |
| Appearance: | White to light yellow powder. |
| Specification: |
?D-Isoleucine (CAS NO.319-78-8), its Synonyms are (2R,3R)-2-Amino-3-methylpentanoic acid ; Isoleucine,D- (8CI) ; (R)-Isoleucine . It is soluble in water, does not dissolve in ether. |
| Storage Temperature: | Store at RT. |
| Color: | Waxy, shiny, rhombic leaflets from alcohol Crystals |
| Usage: | Essential amino acid in humans. |
| Safety Data | |
 |
|
