| Identification | |
| Name: | 1,2,5,6,9,10-Hexabromocyclododecane |
| Synonyms: | 1,2,5,6,9,10-hexabromocyclodecane; HBCD; Hexabromocyclododecane; 1,2,5,6,9,10-hexabromo-cyclododecan; Cyclododecane,1,2,5,6,9,10-hexabromo-; HEXABROMOCYCLODODECANE HT; HBCD HT; 1,2,5,6 9,10-HEXABROMOCYCLODODECANE,TECH. |
| CAS: | 3194-55-6 |
| EINECS: | 221-695-9 |
| Molecular Formula: | C12H18Br6 |
| Molecular Weight: | 641.7 |
| InChI: | InChI=1/C12H18Br6/c13-7-1-2-8(14)10(16)5-6-12(18)11(17)4-3-9(7)15/h7-12H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Density: | 2.145 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.598 |
| Solubility: | Insoluble |
| Appearance: | off-white to beige crystalline powder and chunks |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals Solid |
| Usage: | The main use for 1,2,5,6,9,10-hexabromocyclododecane is as an additive-type flame retardant for extruded and expanded polystyrene foam. Other applications include crystal and high-impact polystyrene, san (styrene-acrylonitrile) resins, adhesives, and coatings. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
