| Identification | |
| Name: | Acetamide,N-ethenyl-N-ethyl- |
| Synonyms: | Acetamide,N-ethyl-N-vinyl- (6CI,7CI,8CI); N-Ethyl-N-vinylacetamide; N-Vinyl-N-ethylacetamide |
| CAS: | 3195-79-7 |
| Molecular Formula: | C6H11 N O |
| Molecular Weight: | 113.18 |
| InChI: | InChI=1/C6H11NO/c1-4-7(5-2)6(3)8/h4H,1,5H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 72.5°C |
| Boiling Point: | 185.2°Cat760mmHg |
| Density: | 0.89g/cm3 |
| Refractive index: | 1.437 |
| Specification: |
N-Ethyl-N-vinylacetamide , its cas register number is 3195-79-7. It also can be called 4-04-00-01054 (Beilstein Handbook Reference) ; BRN 1747032 . N-Ethyl-N-vinylacetamide (CAS NO.3195-79-7) is moderate toxic by ingestion and skin contact and mild toxic by inhalation. When heated to decomposition it emits toxic fumes of NOx |
| Flash Point: | 72.5°C |
| Safety Data | |
 |
|
