Identification |
Name: | Uridine,2'-deoxy-3,4,5,6-tetrahydro- (9CI) |
Synonyms: | 2(1H)-Pyrimidinone,1-(2-deoxy-b-D-erythro-pentofuranosyl)tetrahydro-4-hydroxy-(8CI); 2'-Deoxytetrahydrouridine; Tetrahydrodeoxyuridine |
CAS: | 31962-88-6 |
Molecular Formula: | C9H16 N2 O5 |
Molecular Weight: | 232.23 |
InChI: | InChI=1/C9H16N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h5-8,12-14H,1-4H2,(H,10,15)/t5-,6+,7?,8+/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 327.4°C |
Boiling Point: | 617.8°Cat760mmHg |
Density: | 1.488g/cm3 |
Refractive index: | 1.594 |
Flash Point: | 327.4°C |
Usage: | The novel compounds are specifically used to inhibit deaminating enzymes, which would inactivate cytosine arabinoside by conversion to uridine arabinoside. Cytosine arabinoside is used for its anti-viral, particularly anti-herpes and anticytotoxic a |
Safety Data |
|
|