| Identification |
| Name: | Benzeneacetic acid, a-(phenylthio)-, hydrazide |
| Synonyms: | Aceticacid, phenyl(phenylthio)-, hydrazide (6CI,8CI); NSC 148009 |
| CAS: | 32121-53-2 |
| Molecular Formula: | C14H14 N2 O S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H14N2OS/c15-16-14(17)13(11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10,13H,15H2,(H,16,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 239.6°C |
| Boiling Point: | 472.6°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.659 |
| Flash Point: | 239.6°C |
| Safety Data |
| |
 |