| Identification |
| Name: | 7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one |
| Synonyms: | BUTTPARK 120\07-73;7-BROMO-2H-1,4-BENZOXAZIN-3(4H)-ONE;7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one |
| CAS: | 321436-06-0 |
| Molecular Formula: | C8H6BrNO2 |
| Molecular Weight: | 228.04 |
| InChI: | InChI=1/C8H6BrNO2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11) |
| Molecular Structure: |
![(C8H6BrNO2) BUTTPARK 120\07-73;7-BROMO-2H-1,4-BENZOXAZIN-3(4H)-ONE;7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one](https://img.guidechem.com/structure/321436-06-0.gif) |
| Properties |
| Flash Point: | 184.507°C |
| Boiling Point: | 381.471°C at 760 mmHg |
| Density: | 1.677g/cm3 |
| Refractive index: | 1.601 |
| Flash Point: | 184.507°C |
| Safety Data |
| |
 |