| Identification | |
| Name: | 3,4-Dichlorophenylacetonitrile |
| Synonyms: | 3,4-Dichlorophenyl acetonitrile; 3,4-Dichlorobenzyl cyanide; Benzeneacetonitrile, 3,4-dichloro- 2-(3,4-DICHLOROPHENYL)ACETONITRILE; 3,4-DICHLOROBENZYL CYANIDE 3,4-DCCN; 3,4-Dichlorophenylacetonitrile,98%; 3,4-DICHLOROPHENYLCYANIDE |
| CAS: | 3218-49-3 |
| EINECS: | 221-743-9 |
| Molecular Formula: | C8H5Cl2N |
| Molecular Weight: | 186.04 |
| InChI: | InChI=1/C8H5Cl2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.333g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5631 (26 C) |
| Solubility: | Insoluble |
| Appearance: | white crystalline powder |
| Specification: |
?3,4-dichlorophenylacetonitrile , with CAS number of 3218-49-3, can be called Acetonitrile,(3,4-dichlorophenyl)- (6CI,7CI,8CI) ; (3,4-Dichlorophenyl)acetonitrile ; 3,4-Dichlorobenzeneacetonitrile ; 3,4-Dichlorobenzyl cyanide ; (3,4-Dichlorophenyl)acetonitrile ; Benzeneacetonitrile, 3,4-dichloro- . It is a?white crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
