| Identification | |
| Name: | 2-Naphthaleneboronic acid |
| Synonyms: | Naphthalenyl-2-boronic acid;Naphthalene-2-boronic acid;2-Naphthylboronic acid;2-Naphthene boronic acid;2-Naphthaleneylboronic acid;naphthalen-2-ylboronic acid;naphthalen-2-ylboronicacid;Naphthylene 2-Boronic Acid; |
| CAS: | 32316-92-0 |
| Molecular Formula: | C10H9BO2 |
| Molecular Weight: | 171.99 |
| InChI: | InChI=1/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.638 |
| Appearance: | yellow crystal powde |
| Specification: |
? 2-Naphthaleneboronic acid , with CAS number of 204530-94-9, can be called boronic acid, B-2-naphthalenyl- ; naphthalen-2-ylboronic acid ; naphthalen-2-ylboronicacid ; Naphthylene 2-Boronic Acid ; Naphthalene-2-boronic acid . It is a?yellow crystal powde. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
