| Identification | |
| Name: | trans-2,3-Dibromo-2-butene-1,4-diol |
| Synonyms: | 2,3-Dibromo-2-butene-1,4-diol; trans-2,3-Dibromo-2-buten-1,4-diol; trans-1,4-Dihydroxy-2,3-dibromo-2-butene |
| CAS: | 3234-02-4 |
| EINECS: | 221-779-5 |
| Molecular Formula: | C4H6Br2O2 |
| Molecular Weight: | 245.9 |
| InChI: | InChI=1/C4H6Br2O2/c5-3(1-7)4(6)2-8/h7-8H,1-2H2/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 146.2ºC |
| Boiling Point: | 318.1ºC at 760 mmHg |
| Density: | 2.252 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.63 |
| Solubility: | AUTOIGNITION |
| Appearance: | white crystalline powder |
| Specification: |
Trans-2,3-dibromo-2-butene-1,4-diol (CAS NO.3234-02-4) is a white crystalline powder mainly used as a brominated flame retardant or chemical intermediate. It is stable under ordinary conditions and is probably combustible. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| Flash Point: | 146.2ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
