| Identification | |
| Name: | 1,1'-Biphenyl,4-fluoro- |
| Synonyms: | Biphenyl,4-fluoro- (6CI,7CI,8CI);(4-Fluorophenyl)benzene;4-Fluoro-1,1'-biphenyl;4-Fluorobiphenyl;4'-Fluoro-1,1'-biphenyl;4'-Fluorobiphenyl;NSC 56686;p-Fluorobiphenyl;p-Fluorodiphenyl; |
| CAS: | 324-74-3 |
| EINECS: | 206-304-1 |
| Molecular Formula: | C12H9F |
| Molecular Weight: | 172.2 |
| InChI: | InChI=1/C12H9F/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 ºF |
| Density: | 1.288 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5200 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | Odorless white to light beige crystalline powder |
| Specification: |
1,1'-Biphenyl,4-fluoro- (CAS NO.324-74-3) is also called as (4-Fluorophenyl)benzene ; 4-Fluoro-1,1'-biphenyl ; 4-Fluorobiphenyl ; EINECS 206-304-1 ; NSC 56686 ; p-Fluorodiphenyl ; para-Fluorobiphenyl ; 1,1'-Biphenyl, 4-fluoro- (9CI) ; Biphenyl, 4-fluoro- . |
| Flash Point: | >230 ºF |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
