| Identification |
| Name: | Benzeneacetic acid, a-amino-4-hydroxy-, (aS)- |
| Synonyms: | Benzeneaceticacid, a-amino-4-hydroxy-, (S)-;Glycine,2-(p-hydroxyphenyl)-, L- (8CI);(S)-(4-Hydroxyphenyl)glycine;(S)-2-(4-Hydroxyphenyl)glycine;L-(+)-(p-Hydroxyphenyl)glycine;L-(+)-2-(4-Hydroxyphenyl)glycine;L-(+)-4-Hydroxyphenylglycine;L-(4-Hydroxyphenyl)glycine;L-(p-Hydroxyphenyl)glycine;L-2-(p-Hydroxyphenyl)glycine;L-a-Amino-p-hydroxyphenylacetic acid;Oxfenicine;UK 25842;p-Hydroxy-L-phenylglycine; |
| CAS: | 32462-30-9 |
| EINECS: | 251-061-7 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.162 |
| InChI: | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 240 ºC (dec.) |
| Density: | 1.396 g/cm3 |
| Refractive index: | 1.633 |
| Alpha: | 158 º (C=1% IN 1M HCL) |
| Appearance: | white solid |
| Specification: |
4-Hydroxy-L-phenylglycine , its cas register number is 32462-30-9. It also can be called (S)-2-Amino-2-(4-hydroxyphenyl)essigsaeure ; (S)-alpha-Amino-4-hydroxybenzeneacetic acid ; L-2-(4-Hydroxyphenyl)glycin ; L-2-(p-Hydroxyphenyl)glycine ; Oxfenicina ; Oxfenicine ; Oxfenicinum ; UK 25842 ; UNII-9YH0WH2Z02 . 4-Hydroxy-L-phenylglycine (CAS NO.32462-30-9) is harmful if swallowed. And it is irritating to eyes, respiratory system and skin.
|
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |