| Identification |
| Name: | Hexanoic acid, 3-oxo-,ethyl ester |
| Synonyms: | Caproicacid, b-oxo-, ethyl ester (4CI);3-Oxohexanoic acid ethyl ester;Butyrylacetic acid ethyl ester;Ethyl3-ketohexanoate;Ethyl 3-oxohexanoate;Ethyl 3-propyl-3-oxopropanoate;Ethylbutyroacetate;Ethyl butyroylacetate;Ethyl butyrylacetate;Ethyl a-butyrylacetate;NSC 42868; |
| CAS: | 3249-68-1 |
| EINECS: | 221-835-9 |
| Molecular Formula: | C8H14O3 |
| Molecular Weight: | 158.2 |
| InChI: | InChI=1/C8H14O3/c1-3-5-7(9)6-8(10)11-4-2/h3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.001 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4265-1.4285 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | Immiscible with water |
| Appearance: | colourless liquid |
| HS Code: | 29183000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
