| Identification |
| Name: | L-Norleucine |
| Synonyms: | Norleucine,L- (8CI);(S)-2-Aminohexanoic acid;(S)-Norleucine;(S)-a-Aminohexanoicacid;Caprine;Glycoleucine;Hexanoic acid, 2-amino-, (S)-;L-(+)-Norleucine;L-2-Aminohexanoic acid;NSC10378;NSC 74430;a-Aminocaproic acid;H-Nle-OH;alpha-Aminocaproic acid; |
| CAS: | 327-57-1 |
| EINECS: | 206-321-4 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 275 ºC |
| Boiling Point: | 234°Cat760mmHg |
| Density: | 1.038g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 23 ° (C=5, 5mol/L HCl) |
| Alpha: | 22 º (C=2, 6N HCL) |
| Solubility: | 1.6 g/100 mL (23 ºC) |
| Appearance: | White flakes. |
| HS Code: | 29224995 |
| Flash Point: | 275 ºC |
| Storage Temperature: | Store at RT. |
| Usage: | Internal standard for the analysis of amino acids by gc-ms. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
