Identification |
Name: | Benzaldehyde,4-methoxy-3-methyl- |
Synonyms: | p-Anisaldehyde,3-methyl- (6CI,7CI,8CI);(4-Methoxy-3-methylphenyl)formaldehyde;3-Methyl-4-methoxybenzaldehyde;3-Methyl-p-anisaldehyde;4-Methoxy-3-methylbenzaldehyde;4-Methoxy-3-tolualdehyde; |
CAS: | 32723-67-4 |
EINECS: | 251-177-8 |
Molecular Formula: | C9H10O2 |
Molecular Weight: | 150.17 |
InChI: | InChI=1/C9H10O2/c1-7-5-8(6-10)3-4-9(7)11-2/h3-6H,1-2H3 |
Molecular Structure: |
|
Properties |
Density: | 1.025 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.567-1.57 |
Solubility: | Insoluble |
Appearance: | Clear pale yellow to green liquid |
Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
Safety Data |
|
|