| Identification |
| Name: | Benzaldehyde,4-methoxy-3-methyl- |
| Synonyms: | p-Anisaldehyde,3-methyl- (6CI,7CI,8CI);(4-Methoxy-3-methylphenyl)formaldehyde;3-Methyl-4-methoxybenzaldehyde;3-Methyl-p-anisaldehyde;4-Methoxy-3-methylbenzaldehyde;4-Methoxy-3-tolualdehyde; |
| CAS: | 32723-67-4 |
| EINECS: | 251-177-8 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-7-5-8(6-10)3-4-9(7)11-2/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.025 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567-1.57 |
| Solubility: | Insoluble |
| Appearance: | Clear pale yellow to green liquid |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| |
 |
