| Identification | |
| Name: | 2-Ketoglutaric acid |
| CAS: | 328-50-7 |
| EINECS: | 206-330-3 |
| Molecular Formula: | C5H6O5 |
| Molecular Weight: | 146.1 |
| InChI: | InChI=1/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.499g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.544 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29183000 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
