| Identification | |
| Name: | Nicarbazin |
| CAS: | 330-95-0 |
| EINECS: | 206-359-1 |
| Molecular Formula: | C13H10N4O5.C6H8N2O |
| Molecular Weight: | 426.39 |
| InChI: | InChI=1/C13H10N4O5.C6H8N2O/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22;1-4-3-5(2)8-6(9)7-4/h1-8H,(H2,14,15,18);3H,1-2H3,(H,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | decomposes 265-275 deg C |
| Density: | g/cm3 |
| Solubility: | Practically insoluble in water. Complex is slowly decomposed by trituration with water, or more rapidly by dilute aqueous acids. Slightly soluble in dimethylsulfoxide (DMSO) and dimethylformamide (DMF); insoluble in water and ethanol, however it decomposes slowly when mixed with them |
| Appearance: | Yellow or greenish yellow powder, odorless , with a bit of smell |
| Color: | Crystals Light yellow, fine powder |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
