| Identification |
| Name: | 1H-Pyrazole,3-(4-methoxyphenyl)-1,5-diphenyl- |
| Synonyms: | Pyrazole,3-(p-methoxyphenyl)-1,5-diphenyl- (7CI,8CI); NSC 409743 |
| CAS: | 33045-40-8 |
| Molecular Formula: | C22H18 N2 O |
| Molecular Weight: | 326.39 |
| InChI: | InChI=1/C22H18N2O/c1-25-20-14-12-17(13-15-20)21-16-22(18-8-4-2-5-9-18)24(23-21)19-10-6-3-7-11-19/h2-16H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 260.7°C |
| Boiling Point: | 507.5°Cat760mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.61 |
| Flash Point: | 260.7°C |
| Safety Data |
| |
 |