| Identification |
| Name: | 2-Chlorophenyl isocyanate |
| Synonyms: | Benzene, 1-chloro-2-isocyanato-; |
| CAS: | 3320-83-0 |
| EINECS: | 222-023-7 |
| Molecular Formula: | C7H4ClNO |
| Molecular Weight: | 153.57 |
| InChI: | InChI=1/C7H4ClNO/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2206 |
| Density: | 1.273 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5565-1.5585 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes in water |
| Appearance: | Colorless and Clear liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Safety Data |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
| |
 |
