| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-nitro- |
| Synonyms: | Isonicotinicacid, 2-nitro- (6CI,8CI);2-Nitroisonicotinic acid; |
| CAS: | 33225-74-0 |
| Molecular Formula: | C6H4N2O4 |
| Molecular Weight: | 168.11 |
| InChI: | InChI=1/C6H4N2O4/c9-6(10)4-1-2-7-5(3-4)8(11)12/h1-3H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.57g/cm3 |
| Refractive index: | 1.625 |
| Specification: |
The 2-Nitropyridine-4-carboxylic acid is a chemical compound with formula C6H4N2O4. Its cas registry number is 33225-74-0. Its IUPAC name is called 2-nitropyridine-4-carboxylic acid. This chemical belongs to the categories of pyridines. It is mainly used as a pharmaceutical intermediate. Physical properties about this chemical are: (1)ACD/LogP: 0.08; (2)# of Rule of 5 Violations: 0 ; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 6; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.625; (11)Molar Refractivity: 37.82 cm3; (12)Molar Volume: 107.028 cm3; (13)Surface Tension: 78.949 dyne/cm; (14)Density: 1.571 g/cm3; (15)Flash Point: 262.344 °C; (16)Enthalpy of Vaporization: 82.22 kJ/mol; (17)Boiling Point: 510.174 °C at 760 mmHg. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
