| Identification |
| Name: | Glycine, N,N-dimethyl-,ethyl ester |
| Synonyms: | Dimethylglycineethyl ester;Ethyl (N,N-dimethylamino)acetate;Ethyl (dimethylamino)acetate;Ethyl 2-(dimethylamino)acetate;Ethyl N,N-dimethylglycinate;Ethyldimethylglycinate;N,N-Dimethylglycine ethyl ester; |
| CAS: | 33229-89-9 |
| EINECS: | 251-411-9 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 178.18 |
| InChI: | InChI=1S/C6H13NO2/c1-4-9-6(8)5-7(2)3/h4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 3/PG 3 |
| Flash Point: | 46.2°C |
| Boiling Point: | 150.5°Cat760mmHg |
| Density: | 0.948g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
| Refractive index: | n20/D 1.413(lit.) |
| Appearance: | colourless to slightly yellow-green liquid |
| Packinggroup: | III |
| Flash Point: | 46.2°C |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
