| Identification | |
| Name: | 4-Benzyloxy-3,5-dimethylphenylboronic acid |
| Synonyms: | Boronic acid, B-[3,5-dimethyl-4-(phenylmethoxy)phenyl]-;[4-(Benzyloxy)-3,5-dimethylphenyl]boronic acid; |
| CAS: | 333788-94-6 |
| Molecular Formula: | C15H17BO3 |
| Molecular Weight: | 256.05 |
| InChI: | InChI=1/C15H17BO3/c1-11-8-14(16(17)18)9-12(2)15(11)19-10-13-6-4-3-5-7-13/h3-9,17-18H,10H2,1-2H3 |
| Molecular Structure: | ![(C15H17BO3) Boronic acid, B-[3,5-dimethyl-4-(phenylmethoxy)phenyl]-;[4-(Benzyloxy)-3,5-dimethylphenyl]boronic ac...](https://img.guidechem.com/casimg/333788-94-6.gif) |
| Properties | |
| Flash Point: | 222.2°C |
| Boiling Point: | 443.9°C at 760 mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
The 4-Benzyloxy-3,5-dimethylphenylboronic acid with the cas number 333788-94-6, is also called Boronic acid, B-[3,5-dimethyl-4-(phenylmethoxy)phenyl]- .The properties of the 4-Benzyloxy-3,5-dimethylphenylboronic acid are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 6 ; (4)Polar Surface Area: 27.69 Å2 ; (5)Index of Refraction: 1.579 ; (6)Molar Refractivity: 73.61 cm3 ; (7)Molar Volume: 221.4 cm3 ; (8)Polarizability: 29.18×10-24cm3 ; (9)Surface Tension: 47.3 dyne/cm ; (10)Enthalpy of Vaporization: 73.94 kJ/mol ; (11)Vapour Pressure: 1.17×10-8 mmHg at 25°C. This product can be supplied by the following suppliers: (1)BePharm,Ltd. ; (2)Wuhan Chemwish Technology Co., Ltd.; (3)Beijing Golden Olive Company ; (4)Shanghai PI Chemicals Ltd. ; (5)Nanjing Chemlin Chemical Co., Ltd.; (6)Leap Labchem Co.,Ltd.; (7)Apollo Scientific Ltd. ; (8)Neogen Chemicals Limited; (9)Optimachem; (10)American Custom Chemicals Corporation. You can still convert the following datas into molecular structure : |
| Flash Point: | 222.2°C |
| Safety Data | |
 |
|
