| Identification |
| Name: | Benzene,1-chloro-4-fluoro-2-methyl- |
| Synonyms: | Toluene,2-chloro-5-fluoro- (8CI);1-Chloro-4-fluoro-2-methylbenzene;6,3-Chlorofluorotoluene; |
| CAS: | 33406-96-1 |
| EINECS: | 251-508-6 |
| Molecular Formula: | C7H6ClF |
| Molecular Weight: | 144.57 |
| InChI: | InChI=1/C7H6ClF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1993 |
| Density: | 1.186 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.499-1.501 |
| Appearance: | colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
