| Identification | |
| Name: | 9-Octadecenoic-1-14Cacid, (9Z)- (9CI) |
| Synonyms: | Oleic-1-14Cacid (6CI,7CI,8CI); cis-9-Octadecenoic-1-14C acid |
| CAS: | 3343-81-5 |
| Molecular Formula: | C18H34 O2 |
| Molecular Weight: | 284.48 |
| InChI: | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-/i18+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2910 7 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 0.899g/cm3 |
| Refractive index: | 1.466 |
| Appearance: | ethanol solution |
| Specification: |
Oleic acid, [1-14C] (CAS NO .3343-81-5) and monounsaturated fatty acids may increase the possibility of breast cancer. |
| Flash Point: | °C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
T: Toxic
|
 |
|
