| Identification | |
| Name: | dithianon |
| Synonyms: | 5,10-dihydro-5,10-dioxonaphtho(2,3-b)(1,4)dithiazine-2,3-dicarbonitrile; 1,4-dithiaanthraquinone-2,3-dicarbonitrile; 1,4-dithiaanthraquinone-2,3-dinitrile; 2,3-dicarbonitrilo-1,4-diathiaanthrachinon; 2,3-dinitrilo-1,4-dithia-9,10-anthraquinone; 2,3-dinitrilo-1,4-dithiaanthraquinone; 2,3-dinitrilo-1,4-dithia-anthraquinone; 2,3-dinitrilo-1,4-dithioanthrachinon; 3-b)-1,4-dithiin-2,3-dicarbonitrile,5,10-dihydro-5,10-dioxo-naphtho( |
| CAS: | 3347-22-6 |
| EINECS: | 222-098-6 |
| Molecular Formula: | C14H4N2O2S2 |
| Molecular Weight: | 296.32 |
| InChI: | InChI=1/C14H4N2O2S2/c15-5-9-10(6-16)20-14-12(18)8-4-2-1-3-7(8)11(17)13(14)19-9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Melting Point: | 220 |
| Density: | 1.65 g/cm3 |
| Stability: | Decomposed under alkaline conditions. |
| Refractive index: | 1.775 |
| Solubility: | insoluble |
| Appearance: | Gray-brown needles from acetone. Odorless. |
| Specification: |
Dithianon ,its cas register number is 3347-22-6. It also can be called Delan ; 2,3-Dicyano-1,4-dithiaanthraquinone ; and Stauffer MV 119A . |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Color: | Dark brown crystals, with a coppery luster BROWN CRYSTALS |
| Usage: | Fungicide against many foliar diseases of pome & stone fruit but not against powdery mildews. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
