| Identification |
| Name: | 2,5-Dimethylpyrrolidine, mixture of cis and trans |
| Synonyms: | 2,5-Dimethylpyrrolidine |
| CAS: | 3378-71-0 |
| EINECS: | 222-178-0 |
| Molecular Formula: | C6H13N |
| Molecular Weight: | 99.17 |
| InChI: | InChI=1/C6H13N/c1-5-3-4-6(2)7-5/h5-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 0.81 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.429-1.432 |
| Solubility: | Very soluble |
| Appearance: | Clear colorless to pale yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
| |
 |
