| Identification |
| Name: | 5-Chloro-2-(2,4-dichlorophenoxy)phenol |
| CAS: | 3380-34-5 |
| EINECS: | 222-182-2 |
| Molecular Formula: | C12H7Cl3O2 |
| Molecular Weight: | 289.542 |
| InChI: | InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 162.2 oC |
| Boiling Point: | 344.6 oC at 760 mmHg |
| Density: | 1.49 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Solubility: | 17 mg/l |
| Appearance: | white to off-white powder |
| Packinggroup: | III |
| Flash Point: | 162.2 oC |
| Color: | White to off-white crystalline powder |
| Safety Data |
| Hazard Symbols |
|
| |
 |
