| Identification |
| Name: | Poly(oxy-1,2-ethanediyl),a-(carboxymethyl)-w-(dodecyloxy)-, sodium salt (1:1) |
| Synonyms: | Glycols,polyethylene, dodecyl ether, ether with glycolic acid, sodium salt (8CI);Poly(oxy-1,2-ethanediyl), a-(carboxymethyl)-w-(dodecyloxy)-, sodium salt (9CI); 2P45S; Akypo Foam RL 40; Akypo RLM100NV; Akypo RLM 45N; Akypo RLM 45NV; Akypo-Soft 100NV; Akypo-Soft 160NV;Akypo-Soft 45NV; Beaulight LCA; Beaulight LCA 30D; Biyuraito LCA 30D; ByuraitoLCA 30D; Coladet BSB; Empicol CB 5S; Empicol CED 5/5; Empicol CED 5FL; EnagicolEC 30; Kaoakypo RLM 45NV; Miranate LEC; Miranate LEC 80; Neohitenol 225L;Neohitenol ECL 30S; POE lauryl ether sodium acetate; Polyethylene glycol carboxymethyllauryl ether sodium salt; Polyethylene glycol ether with lauryl alcohol andsodium monochloroacetate; Polyethylene glycol lauryl carboxymethyl ether sodiumsalt; Polyethylene glycol lauryl ether carboxymethyl ether sodium salt;Polyethylene glycol mono(carboxymethyl) monododecyl ether sodium salt;Polyethylene glycol sodium carboxymethyl lauryl ether; Polyoxyethylenecarboxymethyl dodecyl ether sodium salt; Polyoxyethylene lauryl carboxymethylether sodium salt; Polyoxyethylene lauryl ether acetic acid sodium salt;Sandopan 6624; Sandopan LS 24N; Sodium laureth-11 carboxylate; Sodiumlaureth-13 carboxylate; Sodium laureth-4 carboxylate; Sodium laureth-5carboxylate; Sulfine WLL; Surfine WLL-A; a-(Carboxymethyl)-w-(dodecyloxy)poly(oxyethylene) sodium salt |
| CAS: | 33939-64-9 |
| Molecular Formula: | (C2H4 O)n C14 H28 O3 . Na |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C16H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-19-13-14-20-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 138.1°C |
| Boiling Point: | 410.4°Cat760mmHg |
| Density: | 0.961g/cm3 |
| Flash Point: | 138.1°C |
| Safety Data |
| |
 |
