| Identification | |
| Name: | a-D-Galactopyranoside, methyl |
| Synonyms: | Galactopyranoside,methyl, a-D- (8CI);1-O-Methyl-a-D-galactopyranoside;Methyl a-D-galactopyranoside;Methyl a-D-galactoside;Methyl a-galactopyranoside;NSC 33684; |
| CAS: | 3396-99-4 |
| EINECS: | 222-251-7 |
| Molecular Formula: | C7H14O6 |
| Molecular Weight: | 194.18 |
| InChI: | InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189.1 ºC |
| Boiling Point: | 389.1 ºCat 760 mmHg |
| Density: | 1.47 g/cm3 |
| Refractive index: | 176.5 ° (C=1, H2O) |
| Solubility: | 389.1 ºCat 760 mmHg |
| Appearance: | white or off-white powder |
| Specification: |
Methyl alpha-D-galactopyranoside , its cas register number is 3396-99-4. It also can be called hexopyranoside, methyl ; and Methyl hexopyranoside . It is stable. But it incompatible with strong oxidizing agents. Methyl alpha-D-galactopyranoside (CAS NO.3396-99-4) should avoid the condition like incompatible materials and light. Its hazardous decomposition products are carbon monoxide, carbon dioxide. Its hazardous polymerization will not occur. |
| Flash Point: | 189.1 ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
