| Identification |
| Name: | Cyclopentanecarboxylic acid |
| Synonyms: | Cyclopentancarboxylic Acid |
| CAS: | 3400-45-1 |
| EINECS: | 222-269-5 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2,(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3265 |
| Density: | 1.053 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.453-1.545 |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water |
| Appearance: | Colorless liquid |
| HS Code: | 29162000 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
