| Identification |
| Name: | Acetic acid,2-chloro-2-ethoxy-, ethyl ester |
| Synonyms: | Aceticacid, chloroethoxy-, ethyl ester (6CI,7CI,8CI,9CI);2-Chloro-2-ethoxyaceticacid ethyl ester;Ethyl 2-chloro-2-ethoxyacetate;Ethyl 2-(2-chloroethoxy) acetate; |
| CAS: | 34006-60-5 |
| EINECS: | 251-786-9 |
| Molecular Formula: | C6H11ClO3 |
| Molecular Weight: | 166.60274 |
| InChI: | InChI=1S/C6H11ClO3/c1-3-9-5(7)6(8)10-4-2/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 88.5°C |
| Boiling Point: | 216.7°Cat760mmHg |
| Density: | 1.116g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4307 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicity data (The meaning of any toxicological abbr |
| Solubility: | |
| Appearance: | colourless liquid |
| Flash Point: | 88.5°C |
| Safety Data |
| |
 |
