| Identification | |
| Name: | Gold, [1-(thio-kS)-b-D-glucopyranose2,3,4,6-tetraacetato](triethylphosphine)- |
| Synonyms: | Gold,(1-thio-b-D-glucopyranosato)(triethylphosphine)-,2,3,4,6-tetraacetate (8CI); Gold, (1-thio-b-D-glucopyranose2,3,4,6-tetraacetato-S)(triethylphosphine)-; b-D-Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate, goldcomplex; Aktil; Auranofin; Crisinor; Crisofin; NSC 321521; Ridaura; Ridauran;SKF 39162; SKF 39162D; [(Tetra-O-acetyl-b-D-glucopyranosyl)thio](triethylphosphine)gold |
| CAS: | 34031-32-8 |
| EINECS: | 251-801-9 |
| Molecular Formula: | C20H34 Au O9 P S |
| Molecular Weight: | 678.48 |
| InChI: | InChI=1/C14H20O9S.C6H15P.Au/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18;1-4-7(5-2)6-3;/h10-14,24H,5H2,1-4H3;4-6H2,1-3H3;/q;;+1/p-1/t10-,11-,12+,13-,14+;;/m1../s1/rC20H34AuO9PS/c1-8-31(9-2,10-3)21-32-20-19(29-15(7)25)18(28-14(6)24)17(27-13(5)23)16(30-20)11-26-12(4)22/h16-20H,8-11H2,1-7H3/t16-,17-,18+,19-,20+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 103 - 105 |
| Density: | g/cm3 |
| Solubility: | 10 mg/ml in water; 60 mg/ml in ethylene glycol methyl ether; 20 mg/ml in EtOH |
| Appearance: | Needles. |
| Specification: |
The exact mechanism of Auranofin (CAS NO.34031-32-8) action is unknown, but it is believed to act via immunological mechanisms and alteration of lysosomal enzyme activity. Its efficacy is slightly less than that of injected gold salts, but it is better tolerated, and side effects which occur are potentially less serious. |
| Color: | Yellow powder |
| Usage: | Used in the treatment of rheumatoid arthritis. |
| Safety Data | |
 |
|
