| Identification | |
| Name: | Benzene,1-ethoxy-4-nitroso- |
| Synonyms: | Phenetole,p-nitroso- (7CI,8CI); 4-Ethoxy-1-nitrosobenzene; 4-Nitrosophenetole;p-Nitrosophenetole |
| CAS: | 3420-97-1 |
| Molecular Formula: | C8H9 N O2 |
| Molecular Weight: | 151.18 |
| InChI: | InChI=1/C8H9NO2/c1-2-11-8-5-3-7(9-10)4-6-8/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.1°C |
| Boiling Point: | 245.4°Cat760mmHg |
| Density: | 1.07g/cm3 |
| Refractive index: | 1.51 |
| Specification: |
4-Nitrosophenetole , its cas register number is 3420-97-1. It also can be called p-Nitrosophenetole ; 1-Ethoxy-4-nitrosobenzene ; and Phenetole, p-nitroso- . |
| Flash Point: | 115.1°C |
| Safety Data | |
 |
|
