Identification |
Name: | 5H-Dibenzo[b,e][1,4]diazepine,8-chloro-11-(4-methyl-4-oxido-1-piperazinyl)- |
Synonyms: | 5H-Dibenzo[b,e][1,4]diazepine,8-chloro-11-(4-methyl-1-piperazinyl)-, N-oxide (8CI); Clozapine N-oxide |
CAS: | 34233-69-7 |
Molecular Formula: | C18H19 Cl N4 O |
Molecular Weight: | 342.82 |
InChI: | InChI=1/C18H19ClN4O/c1-21-8-10-22(11-9-21)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)23(18)24/h2-7,12,24H,8-11H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6.1/PG 3 |
Flash Point: | 266.7°C |
Boiling Point: | 517.4°Cat760mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.685 |
Packinggroup: | III |
Flash Point: | 266.7°C |
Usage: | A 5-HT2 antagonist. A major metabolite of clozapine that can be monitored by HPLC. Possesses little or no activity towards serotonin receptors |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|