| Identification | |
| Name: | Acetochlor |
| Synonyms: | 2-Chloro-2'-methyl-6'-ethyl-N-ethoxymethyl; Harness; 2-Chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide; 2-Chloro-2'-methyl-6'-ethyl-N-ethoxymethyl-acetanilide; Acenit; MON-097; Top Hand; Topnotc |
| CAS: | 34256-82-1 |
| EINECS: | 251-899-3 |
| Molecular Formula: | C14H20ClNO2 |
| Molecular Weight: | 269.77 |
| InChI: | InChI=1/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3082 9/PG 3 |
| Density: | 1.1 |
| Stability: | Stable at normal temperratures and pressures. |
| Refractive index: | 1.5272 (20 C) |
| Solubility: | 233 mg/L @ 25 C |
| Appearance: | Oily liquid at room temperature, light amber to violet color. Aromatic odor. |
| Color: | Thick oily liquid, light amber to violet Oily liquid at room temperature, light amber to violet color. |
| Usage: | For control of most annual grasses and certain broadleaf weeds and yellow nutsedge. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
