| Identification | |
| Name: | 4-Pyridinepropanoicacid, b-amino- |
| Synonyms: | 4-Pyridinepropionicacid, b-amino- (7CI,8CI);3-Amino-3-(4-pyridyl)propionic acid |
| CAS: | 3429-24-1 |
| Molecular Formula: | C8H10 N2 O2 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C8H10N2O2/c9-7(5-8(11)12)6-1-3-10-4-2-6/h1-4,7H,5,9H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.119°C |
| Boiling Point: | 352.72°C at 760 mmHg |
| Density: | 1.268g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
The 3-Amino-3-(pyridin-4-yl)propanoic acid with the CAS number 3429-24-1 is also called 4-Pyridinepropanoicacid, b-amino-. Its molecular formula is C8H10N2O2. This chemical belongs to the following product categories: (1)pharmacetical; (2)API intermediates. The properties of the chemical are: (1)ACD/LogP: -1.14; (2)# of Rule of 5 Violations: 0 ; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 4; (10)Polar Surface Area: 76.21Å2; (11)Index of Refraction: 1.58; (12)Molar Refractivity: 43.629 cm3; (13)Molar Volume: 131.033 cm3; (14)Polarizability: 17.296×10-24cm3; (15)Surface Tension: 61.736 dyne/cm; (16)Enthalpy of Vaporization: 63.058 kJ/mol; (17)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 167.119°C |
| Safety Data | |
 |
|
