| Identification | |
| Name: | 2,5-Dibromo-4-picoline |
| Synonyms: | 2,5-Dibromo-4-methylpyridine; |
| CAS: | 3430-26-0 |
| Molecular Formula: | C6H5Br2N |
| Molecular Weight: | 250.92 |
| InChI: | InChI=1/C6H5Br2N/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.911 g/cm3 |
| Refractive index: | 1.593 |
| Appearance: | light yellow to orange low melting solid |
| Specification: |
2,5-Dibromo-4-picoline , its cas register number is 3430-26-0. It also can be called 2,5-Dibromo-4-methylpyridine .It is a light yellow to orange low melting solid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
