| Identification | |
| Name: | PJ-34 |
| Synonyms: | n-(6-oxo-5,6-dihydrophenanthridin-2-yl)-(n,n-dimethylamino)acetamide hydrochloride;PJ-34 hydrate hydrochloride;PJ 34 Hydrochloride |
| CAS: | 344458-15-7 |
| Molecular Formula: | C17H17N3O2HCl |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H17N3O2.ClH.H2O/c1-20(2)10-16(21)18-11-7-8-15-14(9-11)12-5-3-4-6-13(12)17(22)19-15;;/h3-9H,10H2,1-2H3,(H,18,21)(H,19,22);1H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 279.9°C |
| Boiling Point: | 539.1°C at 760 mmHg |
| Biological Activity: | Potent inhibitor of poly(ADP-ribose) polymerase (PARP) (EC 50 = 20 nM). ~ 1000-fold more potent than 3-Aminobenzamide . Protects primary neuronal cells from oxygen-glucose deprivation in vitro and reduces infarct size following focal cerebral ischemia in vivo . |
| Flash Point: | 279.9°C |
| Safety Data | |
 |
|
