| Identification |
| Name: | Benzoic acid,5-fluoro-2-hydroxy- |
| Synonyms: | Salicylicacid, 5-fluoro- (6CI,7CI,8CI);2-Hydroxy-5-fluorobenzoic acid;5-Fluoro-2-hydroxybenzoic acid;NSC 46619;5-Fluoro-2-hydroxybenzoic acid; |
| CAS: | 345-16-4 |
| EINECS: | 206-455-3 |
| Molecular Formula: | C7H5FO3 |
| Molecular Weight: | 156.11 |
| InChI: | InChI=1/C7H5FO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.492 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.554 |
| Solubility: | Very soluble |
| Appearance: | White to off-white powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | light brown |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
