| Identification | |
| Name: | 4-fluorobenzophenone |
| Synonyms: | (4-Fluorophenyl)(phenyl)methanone; (4-Fluorophenyl)phenyl-methanone; p-fluorobenzophenone |
| CAS: | 345-83-5 |
| EINECS: | 206-463-7 |
| Molecular Formula: | C13H9FO |
| Molecular Weight: | 200.21 |
| InChI: | InChI=1/C13H9FO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 73 C |
| Density: | 130 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.566 |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | white to yellow crystals |
| Specification: |
4-Fluorobenzophenone (CAS NO.345-83-5) is also called p-Fluorobenzophenone ; Methanone, (4-fluorophenyl)phenyl-;4-fluorobenzophenone ; (4-fFuorophenyl)(phenyl)methanone ; Labotest-bb LT00159548 ; para-Fluorobenzophenone . |
| Flash Point: | 73 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
