| Identification |
| Name: | 4,4'-Difluorobenzophenone |
| Synonyms: | Bis(p-fluorophenyl) ketone;Bis(4-fluorophenyl) ketone;4-07-00-01374 (Beilstein Handbook Reference);Bis(4-fluorophenyl)methanone;p,p-Difluorobenzophenone;Methanone, bis(4-fluorophenyl)- (9CI);Benzophenone, 4,4-difluoro-;Di-p-fluorophenyl ketone;4,4-Difluorobenzophenone;Methanone, bis (4-fluorophenyl)-;4,4'-Difluro benzophenone;4,4'-Difluoroacetophenone;4,4'-difluoro-benzophenon; |
| CAS: | 345-92-6 |
| EINECS: | 206-466-3 |
| Molecular Formula: | C13H8F2O |
| Molecular Weight: | 218.2 |
| InChI: | InChI=1/C13H8F2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.239g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.544 |
| Solubility: | Insoluble |
| Appearance: | White to off-white solid. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
