| Identification |
| Name: | 2,7-Dimethoxynaphthalene |
| Synonyms: | NSC 28991;Naphthalene, 2,7-dimethoxy-; |
| CAS: | 3469-26-9 |
| EINECS: | 222-433-6 |
| Molecular Formula: | C12H12O2 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.097 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.584 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | grey to brown powder |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
